General Science IBDP Biology Uncategorized 10. Organic Chemistry June 3, 2021 Shveta 0 Comments ibdp chemistry, Organic Chemistry 1.Which statement about the reactions of halogenoalkanes with aqueous sodium hydroxide is correct?Primary halogenoalkanes react mainly by an SN1 mechanismChloroalkanes react faster than iodoalkanesTertiary halogenoalkanes react faster than primary halogenoalkanesThe rate of an SN1 reaction depends on the concentration of aqueous sodium hydroxide2. Which compound can exist as optical isomers?H2NCH2COOHCH2ClCH2ClCH3CHBrIHCOOCH33. Which compound reacts most rapidly by a SN1 mechanism?(CH3)3CClCH3CH2CH2CH2Br(CH3)3CBrCH3CH2CH2CH2Cl4. Which compound can exist as optical isomers?CH3CHBrCH3CH2ClCH(OH)CH2ClCH3CHBrCOOHCH3CCl2CH2OH5.Which pair of compounds can be used to prepare CH3COOCH3?Ethanol and methanoic acidMethanol and ethanoic acidEthanol and ethanoic acidMethanol and methanoic acid6. Which pair of compounds can be used to prepare CH3COOCH3?Ethanol and methanoic acidMethanol and ethanoic acidEthanol and ethanoic acidMethanol and methanoic acid7. Nylon is a condensation polymer made up of hexanedioic acid and 1,6-diaminohexane.Which type of linkage is present in nylon?AmideEsterAmineCarboxyl8. How many chiral carbon atoms are present in a molecule of glucose? 12349. Which amino acid can exist as optical isomers? ABCD10. What is the product of the following reaction? CH3CH2CH2NH2CH3CH2CH2CH3CH3CH2CH2CH2CH3CH3CH2CH2CH2NH211. What is the correct IUPAC name for the following compound? 4-methylbutanenitrile4-methylpentanenitrile2-methylbutanenitrile2-methylpentanenitrile12. What is the organic product of the reaction between ethanol and ethanoic acid in the presence of sulfuric acid?CH3CHOCH3COOCH3CH3CH2COOCH3CH3COOCH2CH313. Which compound can exist as optical isomers?H2NCH2COOHH3CCONH2H3CCHBrIHCOOCH3
